C21H22N6O — CID 139323954
[2-[1-[[6-(3-amino-1H-indazol-5-yl)pyridazin-3-yl]amino]propan-2-yl]phenyl]methanol (PubChem CID 139323954) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is [2-[1-[[6-(3-amino-1H-indazol-5-yl)pyridazin-3-yl]amino]propan-2-yl]phenyl]methanol.
| Compound Name | [2-[1-[[6-(3-amino-1H-indazol-5-yl)pyridazin-3-yl]amino]propan-2-yl]phenyl]methanol |
|---|---|
| PubChem CID | 139323954 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | [2-[1-[[6-(3-amino-1H-indazol-5-yl)pyridazin-3-yl]amino]propan-2-yl]phenyl]methanol |
| SMILES | CC(CNc1ccc(-c2ccc3[nH]nc(N)c3c2)nn1)c1ccccc1CO |
| InChI | InChI=1S/C21H22N6O/c1-13(16-5-3-2-4-15(16)12-28)11-23-20-9-8-18(24-26-20)14-6-7-19-17(10-14)21(22)27-25-19/h2-10,13,28H,11-12H2,1H3,(H,23,26)(H3,22,25,27) |
| InChIKey | YLCFRLFCPNONSA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |