C27H32FN7O2 — CID 139323915
tert-butyl N-[2-[[5-[6-[2-(4-fluorophenyl)propylamino]pyridazin-3-yl]-1H-indazol-3-yl]amino]ethyl]carbamate (PubChem CID 139323915) has the molecular formula C27H32FN7O2 and a molecular weight of 505.60 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-[6-[2-(4-fluorophenyl)propylamino]pyridazin-3-yl]-1H-indazol-3-yl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-[6-[2-(4-fluorophenyl)propylamino]pyridazin-3-yl]-1H-indazol-3-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 139323915 |
| Molecular Formula | C27H32FN7O2 |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | tert-butyl N-[2-[[5-[6-[2-(4-fluorophenyl)propylamino]pyridazin-3-yl]-1H-indazol-3-yl]amino]ethyl]carbamate |
| SMILES | CC(CNc1ccc(-c2ccc3[nH]nc(NCCNC(=O)OC(C)(C)C)c3c2)nn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H32FN7O2/c1-17(18-5-8-20(28)9-6-18)16-31-24-12-11-22(32-34-24)19-7-10-23-21(15-19)25(35-33-23)29-13-14-30-26(36)37-27(2,3)4/h5-12,15,17H,13-14,16H2,1-4H3,(H,30,36)(H,31,34)(H2,29,33,35) |
| InChIKey | PZUSOXGKKNSVGX-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 116.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|