C19H30BrN3O2 — CID 139324426
1-[5-bromo-2-[[3-(cyclohexylamino)-5-hydroxy-4-methylpentyl]amino]-3-pyridinyl]ethanone (PubChem CID 139324426) has the molecular formula C19H30BrN3O2 and a molecular weight of 412.37 g/mol. Its IUPAC name is 1-[5-bromo-2-[[3-(cyclohexylamino)-5-hydroxy-4-methylpentyl]amino]-3-pyridinyl]ethanone.
| Compound Name | 1-[5-bromo-2-[[3-(cyclohexylamino)-5-hydroxy-4-methylpentyl]amino]-3-pyridinyl]ethanone |
|---|---|
| PubChem CID | 139324426 |
| Molecular Formula | C19H30BrN3O2 |
| Molecular Weight | 412.37 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-[5-bromo-2-[[3-(cyclohexylamino)-5-hydroxy-4-methylpentyl]amino]-3-pyridinyl]ethanone |
| SMILES | CC(=O)c1cc(Br)cnc1NCCC(NC1CCCCC1)C(C)CO |
| InChI | InChI=1S/C19H30BrN3O2/c1-13(12-24)18(23-16-6-4-3-5-7-16)8-9-21-19-17(14(2)25)10-15(20)11-22-19/h10-11,13,16,18,23-24H,3-9,12H2,1-2H3,(H,21,22) |
| InChIKey | QOWVDYVYENRFDA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |