C17H26BrN3O4 — CID 139324896
methyl 5-bromo-2-[[4-hydroxy-3-(oxan-4-ylamino)pentyl]amino]pyridine-3-carboxylate (PubChem CID 139324896) has the molecular formula C17H26BrN3O4 and a molecular weight of 416.32 g/mol. Its IUPAC name is methyl 5-bromo-2-[[4-hydroxy-3-(oxan-4-ylamino)pentyl]amino]pyridine-3-carboxylate.
| Compound Name | methyl 5-bromo-2-[[4-hydroxy-3-(oxan-4-ylamino)pentyl]amino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 139324896 |
| Molecular Formula | C17H26BrN3O4 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 5-bromo-2-[[4-hydroxy-3-(oxan-4-ylamino)pentyl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cc(Br)cnc1NCCC(NC1CCOCC1)C(C)O |
| InChI | InChI=1S/C17H26BrN3O4/c1-11(22)15(21-13-4-7-25-8-5-13)3-6-19-16-14(17(23)24-2)9-12(18)10-20-16/h9-11,13,15,21-22H,3-8H2,1-2H3,(H,19,20) |
| InChIKey | FNZVOZGFOXJKRY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |