C18H28IN3O2 — CID 144575420
methyl 2-[3-(cyclohexylamino)pentylamino]-5-iodopyridine-3-carboxylate (PubChem CID 144575420) has the molecular formula C18H28IN3O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is methyl 2-[3-(cyclohexylamino)pentylamino]-5-iodopyridine-3-carboxylate.
| Compound Name | methyl 2-[3-(cyclohexylamino)pentylamino]-5-iodopyridine-3-carboxylate |
|---|---|
| PubChem CID | 144575420 |
| Molecular Formula | C18H28IN3O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | methyl 2-[3-(cyclohexylamino)pentylamino]-5-iodopyridine-3-carboxylate |
| SMILES | CCC(CCNc1ncc(I)cc1C(=O)OC)NC1CCCCC1 |
| InChI | InChI=1S/C18H28IN3O2/c1-3-14(22-15-7-5-4-6-8-15)9-10-20-17-16(18(23)24-2)11-13(19)12-21-17/h11-12,14-15,22H,3-10H2,1-2H3,(H,20,21) |
| InChIKey | MPTMGIQUBGCXKL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|