C17H15FIN6OP — CID 139324944
2-[4-[3-[(4-fluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]pyrazol-1-yl]ethoxy-iodophosphane (PubChem CID 139324944) has the molecular formula C17H15FIN6OP and a molecular weight of 496.22 g/mol. Its IUPAC name is 2-[4-[3-[(4-fluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]pyrazol-1-yl]ethoxy-iodophosphane.
| Compound Name | 2-[4-[3-[(4-fluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]pyrazol-1-yl]ethoxy-iodophosphane |
|---|---|
| PubChem CID | 139324944 |
| Molecular Formula | C17H15FIN6OP |
| Molecular Weight | 496.22 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | 2-[4-[3-[(4-fluorophenyl)methyl]triazolo[4,5-b]pyridin-5-yl]pyrazol-1-yl]ethoxy-iodophosphane |
| SMILES | Fc1ccc(Cn2nnc3ccc(-c4cnn(CCOPI)c4)nc32)cc1 |
| InChI | InChI=1S/C17H15FIN6OP/c18-14-3-1-12(2-4-14)10-25-17-16(22-23-25)6-5-15(21-17)13-9-20-24(11-13)7-8-26-27-19/h1-6,9,11,27H,7-8,10H2 |
| InChIKey | GJXMTZCUJYYMKR-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|