C23H20FN3O2 — CID 139325533
N-(2-amino-4-fluorophenyl)-4-[[(1R)-2-phenylcyclopropanecarbonyl]amino]benzamide (PubChem CID 139325533) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-4-[[(1R)-2-phenylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-4-[[(1R)-2-phenylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 139325533 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-4-[[(1R)-2-phenylcyclopropanecarbonyl]amino]benzamide |
| SMILES | Nc1cc(F)ccc1NC(=O)c1ccc(NC(=O)[C@@H]2CC2c2ccccc2)cc1 |
| InChI | InChI=1S/C23H20FN3O2/c24-16-8-11-21(20(25)12-16)27-22(28)15-6-9-17(10-7-15)26-23(29)19-13-18(19)14-4-2-1-3-5-14/h1-12,18-19H,13,25H2,(H,26,29)(H,27,28)/t18?,19-/m1/s1 |
| InChIKey | UVUXWUYEHXADCJ-MUMRKEEXSA-N |
| XLogP | 4.40 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|