C24H23N3O2 — CID 157443710
N-(2-amino-4-methylphenyl)-4-[[(1R,2S)-2-phenylcyclopropanecarbonyl]amino]benzamide (PubChem CID 157443710) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is N-(2-amino-4-methylphenyl)-4-[[(1R,2S)-2-phenylcyclopropanecarbonyl]amino]benzamide.
| Compound Name | N-(2-amino-4-methylphenyl)-4-[[(1R,2S)-2-phenylcyclopropanecarbonyl]amino]benzamide |
|---|---|
| PubChem CID | 157443710 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N-(2-amino-4-methylphenyl)-4-[[(1R,2S)-2-phenylcyclopropanecarbonyl]amino]benzamide |
| SMILES | Cc1ccc(NC(=O)c2ccc(NC(=O)[C@@H]3C[C@@H]3c3ccccc3)cc2)c(N)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-15-7-12-22(21(25)13-15)27-23(28)17-8-10-18(11-9-17)26-24(29)20-14-19(20)16-5-3-2-4-6-16/h2-13,19-20H,14,25H2,1H3,(H,26,29)(H,27,28)/t19-,20-/m1/s1 |
| InChIKey | BRYYZSGIUVGQBV-WOJBJXKFSA-N |
| XLogP | 4.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|