C15H12F3N3O3 — CID 139328525
N-(cyclopropylmethyl)-2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide (PubChem CID 139328525) has the molecular formula C15H12F3N3O3 and a molecular weight of 339.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 139328525 |
| Molecular Formula | C15H12F3N3O3 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-(cyclopropylmethyl)-2-oxo-2-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]acetamide |
| SMILES | O=C(NCC1CC1)C(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H12F3N3O3/c16-15(17,18)14-20-12(21-24-14)10-5-3-9(4-6-10)11(22)13(23)19-7-8-1-2-8/h3-6,8H,1-2,7H2,(H,19,23) |
| InChIKey | BQSMYEDGSZDGAE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|