C15H11F3N2O4 — CID 157253220
3-(oxetan-3-yl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propane-1,2-dione (PubChem CID 157253220) has the molecular formula C15H11F3N2O4 and a molecular weight of 340.26 g/mol. Its IUPAC name is 3-(oxetan-3-yl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propane-1,2-dione.
| Compound Name | 3-(oxetan-3-yl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propane-1,2-dione |
|---|---|
| PubChem CID | 157253220 |
| Molecular Formula | C15H11F3N2O4 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 3-(oxetan-3-yl)-1-[4-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]propane-1,2-dione |
| SMILES | O=C(CC1COC1)C(=O)c1ccc(-c2noc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H11F3N2O4/c16-15(17,18)14-19-13(20-24-14)10-3-1-9(2-4-10)12(22)11(21)5-8-6-23-7-8/h1-4,8H,5-7H2 |
| InChIKey | AWOQKJDRHLHXCV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|