C12H12ClF3N2O2 — CID 139332209
(4S)-8-chloro-4-methyl-6-[2-(trifluoromethyl)oxiran-2-yl]-2,3-dihydropyrano[2,3-c]pyridin-4-amine (PubChem CID 139332209) has the molecular formula C12H12ClF3N2O2 and a molecular weight of 308.69 g/mol. Its IUPAC name is (4S)-8-chloro-4-methyl-6-[2-(trifluoromethyl)oxiran-2-yl]-2,3-dihydropyrano[2,3-c]pyridin-4-amine.
| Compound Name | (4S)-8-chloro-4-methyl-6-[2-(trifluoromethyl)oxiran-2-yl]-2,3-dihydropyrano[2,3-c]pyridin-4-amine |
|---|---|
| PubChem CID | 139332209 |
| Molecular Formula | C12H12ClF3N2O2 |
| Molecular Weight | 308.69 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | (4S)-8-chloro-4-methyl-6-[2-(trifluoromethyl)oxiran-2-yl]-2,3-dihydropyrano[2,3-c]pyridin-4-amine |
| SMILES | C[C@]1(N)CCOc2c1cc(C1(C(F)(F)F)CO1)nc2Cl |
| InChI | InChI=1S/C12H12ClF3N2O2/c1-10(17)2-3-19-8-6(10)4-7(18-9(8)13)11(5-20-11)12(14,15)16/h4H,2-3,5,17H2,1H3/t10-,11?/m0/s1 |
| InChIKey | ATAWAANVRZWUAL-VUWPPUDQSA-N |
| XLogP | 2.48 |
| TPSA | 60.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.69 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|