C12H19N — CID 139333567
1-ethenyl-4-[(2E)-penta-2,4-dien-2-yl]piperidine (PubChem CID 139333567) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-ethenyl-4-[(2E)-penta-2,4-dien-2-yl]piperidine.
| Compound Name | 1-ethenyl-4-[(2E)-penta-2,4-dien-2-yl]piperidine |
|---|---|
| PubChem CID | 139333567 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-ethenyl-4-[(2E)-penta-2,4-dien-2-yl]piperidine |
| SMILES | C=C/C=C(\C)C1CCN(C=C)CC1 |
| InChI | InChI=1S/C12H19N/c1-4-6-11(3)12-7-9-13(5-2)10-8-12/h4-6,12H,1-2,7-10H2,3H3/b11-6+ |
| InChIKey | CZZFUHLUMYWREO-IZZDOVSWSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|