C24H22BrN3O4 — CID 139337003
4-[(6-bromo-3-pyridinyl)oxy]-6,7-dimethoxy-N-[(4-methoxyphenyl)methyl]quinolin-2-amine (PubChem CID 139337003) has the molecular formula C24H22BrN3O4 and a molecular weight of 496.36 g/mol. Its IUPAC name is 4-[(6-bromo-3-pyridinyl)oxy]-6,7-dimethoxy-N-[(4-methoxyphenyl)methyl]quinolin-2-amine.
| Compound Name | 4-[(6-bromo-3-pyridinyl)oxy]-6,7-dimethoxy-N-[(4-methoxyphenyl)methyl]quinolin-2-amine |
|---|---|
| PubChem CID | 139337003 |
| Molecular Formula | C24H22BrN3O4 |
| Molecular Weight | 496.36 g/mol |
| Exact Mass | 495.08 |
| IUPAC Name | 4-[(6-bromo-3-pyridinyl)oxy]-6,7-dimethoxy-N-[(4-methoxyphenyl)methyl]quinolin-2-amine |
| SMILES | COc1ccc(CNc2cc(Oc3ccc(Br)nc3)c3cc(OC)c(OC)cc3n2)cc1 |
| InChI | InChI=1S/C24H22BrN3O4/c1-29-16-6-4-15(5-7-16)13-27-24-12-20(32-17-8-9-23(25)26-14-17)18-10-21(30-2)22(31-3)11-19(18)28-24/h4-12,14H,13H2,1-3H3,(H,27,28) |
| InChIKey | XRTFRCPJFVOVEH-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.36 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|