C21H28N4O4 — CID 139338434
ethyl N-[4-(7-morpholin-4-ylquinazolin-5-yl)oxycyclohexyl]carbamate (PubChem CID 139338434) has the molecular formula C21H28N4O4 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl N-[4-(7-morpholin-4-ylquinazolin-5-yl)oxycyclohexyl]carbamate.
| Compound Name | ethyl N-[4-(7-morpholin-4-ylquinazolin-5-yl)oxycyclohexyl]carbamate |
|---|---|
| PubChem CID | 139338434 |
| Molecular Formula | C21H28N4O4 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | ethyl N-[4-(7-morpholin-4-ylquinazolin-5-yl)oxycyclohexyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(Oc2cc(N3CCOCC3)cc3ncncc23)CC1 |
| InChI | InChI=1S/C21H28N4O4/c1-2-28-21(26)24-15-3-5-17(6-4-15)29-20-12-16(25-7-9-27-10-8-25)11-19-18(20)13-22-14-23-19/h11-15,17H,2-10H2,1H3,(H,24,26) |
| InChIKey | LTIKYPQVLSJJNA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |