C22H25FN6O2 — CID 121335808
5-fluoro-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-4-amine (PubChem CID 121335808) has the molecular formula C22H25FN6O2 and a molecular weight of 424.48 g/mol. Its IUPAC name is 5-fluoro-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-4-amine.
| Compound Name | 5-fluoro-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 121335808 |
| Molecular Formula | C22H25FN6O2 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 5-fluoro-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrimidin-4-amine |
| SMILES | Fc1cncnc1NC1CCC(Oc2cc(N3CCOCC3)cc3nccnc23)CC1 |
| InChI | InChI=1S/C22H25FN6O2/c23-18-13-24-14-27-22(18)28-15-1-3-17(4-2-15)31-20-12-16(29-7-9-30-10-8-29)11-19-21(20)26-6-5-25-19/h5-6,11-15,17H,1-4,7-10H2,(H,24,27,28) |
| InChIKey | LPBDWJUUOHSGDA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 85.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |