C24H26F3N5O2 — CID 121335931
N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]-6-(trifluoromethyl)pyridin-3-amine (PubChem CID 121335931) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]-6-(trifluoromethyl)pyridin-3-amine.
| Compound Name | N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]-6-(trifluoromethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 121335931 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]-6-(trifluoromethyl)pyridin-3-amine |
| SMILES | FC(F)(F)c1ccc(NC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)cn1 |
| InChI | InChI=1S/C24H26F3N5O2/c25-24(26,27)22-6-3-17(15-30-22)31-16-1-4-19(5-2-16)34-21-14-18(32-9-11-33-12-10-32)13-20-23(21)29-8-7-28-20/h3,6-8,13-16,19,31H,1-2,4-5,9-12H2 |
| InChIKey | RAOMKSBEIAHEQQ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |