C24H29N5O3 — CID 121335616
3-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine (PubChem CID 121335616) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is 3-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine.
| Compound Name | 3-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine |
|---|---|
| PubChem CID | 121335616 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | 3-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine |
| SMILES | COc1cccnc1NC1CCC(Oc2cc(N3CCOCC3)cc3nccnc23)CC1 |
| InChI | InChI=1S/C24H29N5O3/c1-30-21-3-2-8-27-24(21)28-17-4-6-19(7-5-17)32-22-16-18(29-11-13-31-14-12-29)15-20-23(22)26-10-9-25-20/h2-3,8-10,15-17,19H,4-7,11-14H2,1H3,(H,27,28) |
| InChIKey | QLWJMWDXJVPHTI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |