C26H30N6O2 — CID 121335817
1-methyl-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]indazol-3-amine (PubChem CID 121335817) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 1-methyl-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]indazol-3-amine.
| Compound Name | 1-methyl-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]indazol-3-amine |
|---|---|
| PubChem CID | 121335817 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-methyl-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]indazol-3-amine |
| SMILES | Cn1nc(NC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H30N6O2/c1-31-23-5-3-2-4-21(23)26(30-31)29-18-6-8-20(9-7-18)34-24-17-19(32-12-14-33-15-13-32)16-22-25(24)28-11-10-27-22/h2-5,10-11,16-18,20H,6-9,12-15H2,1H3,(H,29,30) |
| InChIKey | VNRAZKYIZZAQOG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 77.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |