C23H28N6O3 — CID 90454133
5-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrazin-2-amine (PubChem CID 90454133) has the molecular formula C23H28N6O3 and a molecular weight of 436.52 g/mol. Its IUPAC name is 5-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrazin-2-amine.
| Compound Name | 5-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 90454133 |
| Molecular Formula | C23H28N6O3 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 5-methoxy-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyrazin-2-amine |
| SMILES | COc1cnc(NC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)cn1 |
| InChI | InChI=1S/C23H28N6O3/c1-30-22-15-26-21(14-27-22)28-16-2-4-18(5-3-16)32-20-13-17(29-8-10-31-11-9-29)12-19-23(20)25-7-6-24-19/h6-7,12-16,18H,2-5,8-11H2,1H3,(H,26,28) |
| InChIKey | VMWHJRRGIPHOJW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |