C25H31N5O3 — CID 121335607
4-(methoxymethyl)-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine (PubChem CID 121335607) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is 4-(methoxymethyl)-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine.
| Compound Name | 4-(methoxymethyl)-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine |
|---|---|
| PubChem CID | 121335607 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 4-(methoxymethyl)-N-[4-(7-morpholin-4-ylquinoxalin-5-yl)oxycyclohexyl]pyridin-2-amine |
| SMILES | COCc1ccnc(NC2CCC(Oc3cc(N4CCOCC4)cc4nccnc34)CC2)c1 |
| InChI | InChI=1S/C25H31N5O3/c1-31-17-18-6-7-27-24(14-18)29-19-2-4-21(5-3-19)33-23-16-20(30-10-12-32-13-11-30)15-22-25(23)28-9-8-26-22/h6-9,14-16,19,21H,2-5,10-13,17H2,1H3,(H,27,29) |
| InChIKey | NAQJHAOSTANEGG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |