C17H24N6O — CID 139338612
(Z)-2-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carboximidoyl)-N,3-dimethylpent-2-enamide (PubChem CID 139338612) has the molecular formula C17H24N6O and a molecular weight of 328.42 g/mol. Its IUPAC name is (Z)-2-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carboximidoyl)-N,3-dimethylpent-2-enamide.
| Compound Name | (Z)-2-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carboximidoyl)-N,3-dimethylpent-2-enamide |
|---|---|
| PubChem CID | 139338612 |
| Molecular Formula | C17H24N6O |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (Z)-2-(4-amino-7-propan-2-ylpyrrolo[2,3-d]pyrimidine-5-carboximidoyl)-N,3-dimethylpent-2-enamide |
| SMILES | [H]/N=C(C(\C(=O)NC)=C(/C)CC)/c1cn(C(C)C)c2ncnc(N)c12 |
| InChI | InChI=1S/C17H24N6O/c1-6-10(4)12(17(24)20-5)14(18)11-7-23(9(2)3)16-13(11)15(19)21-8-22-16/h7-9,18H,6H2,1-5H3,(H,20,24)(H2,19,21,22)/b12-10-,18-14- |
| InChIKey | LYCAKVVZBQDPFH-KHYUPNNASA-N |
| XLogP | 2.43 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|