C6H10F3NO2 — CID 139343396
[(2S,6S)-6-(trifluoromethyl)morpholin-2-yl]methanol (PubChem CID 139343396) has the molecular formula C6H10F3NO2 and a molecular weight of 185.14 g/mol. Its IUPAC name is [(2S,6S)-6-(trifluoromethyl)morpholin-2-yl]methanol.
| Compound Name | [(2S,6S)-6-(trifluoromethyl)morpholin-2-yl]methanol |
|---|---|
| PubChem CID | 139343396 |
| Molecular Formula | C6H10F3NO2 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | [(2S,6S)-6-(trifluoromethyl)morpholin-2-yl]methanol |
| SMILES | OC[C@@H]1CNC[C@@H](C(F)(F)F)O1 |
| InChI | InChI=1S/C6H10F3NO2/c7-6(8,9)5-2-10-1-4(3-11)12-5/h4-5,10-11H,1-3H2/t4-,5-/m0/s1 |
| InChIKey | ZBHWZKGOGDZROC-WHFBIAKZSA-N |
| XLogP | -0.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |