C6H14ClNO2 — CID 51357959
[(2S,5R)-5-methylmorpholin-2-yl]methanol;hydrochloride (PubChem CID 51357959) has the molecular formula C6H14ClNO2 and a molecular weight of 167.64 g/mol. Its IUPAC name is [(2S,5R)-5-methylmorpholin-2-yl]methanol;hydrochloride.
| Compound Name | [(2S,5R)-5-methylmorpholin-2-yl]methanol;hydrochloride |
|---|---|
| PubChem CID | 51357959 |
| Molecular Formula | C6H14ClNO2 |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | [(2S,5R)-5-methylmorpholin-2-yl]methanol;hydrochloride |
| SMILES | C[C@@H]1CO[C@H](CO)CN1.Cl |
| InChI | InChI=1S/C6H13NO2.ClH/c1-5-4-9-6(3-8)2-7-5;/h5-8H,2-4H2,1H3;1H/t5-,6+;/m1./s1 |
| InChIKey | ANHSOVKVDCYFOR-IBTYICNHSA-N |
| XLogP | -0.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |