C12H24N2O4S — CID 139345066
2-heptyl-1,3-dimethylimidazol-1-ium;hydron;sulfate (PubChem CID 139345066) has the molecular formula C12H24N2O4S and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-heptyl-1,3-dimethylimidazol-1-ium;hydron;sulfate.
| Compound Name | 2-heptyl-1,3-dimethylimidazol-1-ium;hydron;sulfate |
|---|---|
| PubChem CID | 139345066 |
| Molecular Formula | C12H24N2O4S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 2-heptyl-1,3-dimethylimidazol-1-ium;hydron;sulfate |
| SMILES | CCCCCCCc1n(C)cc[n+]1C.O=S(=O)([O-])[O-].[H+] |
| InChI | InChI=1S/C12H23N2.H2O4S/c1-4-5-6-7-8-9-12-13(2)10-11-14(12)3;1-5(2,3)4/h10-11H,4-9H2,1-3H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | LCZLDZHOPKRSOV-UHFFFAOYSA-M |
| XLogP | 1.14 |
| TPSA | 89.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|