C27H25Cl2N3O3 — CID 139345385
5-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2,3-dihydroisoindol-1-one (PubChem CID 139345385) has the molecular formula C27H25Cl2N3O3 and a molecular weight of 510.42 g/mol. Its IUPAC name is 5-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 139345385 |
| Molecular Formula | C27H25Cl2N3O3 |
| Molecular Weight | 510.42 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | 5-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1NCc2cc(N3C[C@@H]4C[C@H]3C[C@H]4OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)ccc21 |
| InChI | InChI=1S/C27H25Cl2N3O3/c28-21-2-1-3-22(29)24(21)25-20(26(35-31-25)14-4-5-14)13-34-23-10-18-9-16(23)12-32(18)17-6-7-19-15(8-17)11-30-27(19)33/h1-3,6-8,14,16,18,23H,4-5,9-13H2,(H,30,33)/t16-,18-,23+/m0/s1 |
| InChIKey | HXWTXISBBSVPOY-TXBYWVTISA-N |
| XLogP | 5.95 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |