C32H34Cl2N2O4 — CID 139345690
ethyl 6-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxylate (PubChem CID 139345690) has the molecular formula C32H34Cl2N2O4 and a molecular weight of 581.54 g/mol. Its IUPAC name is ethyl 6-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxylate.
| Compound Name | ethyl 6-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 139345690 |
| Molecular Formula | C32H34Cl2N2O4 |
| Molecular Weight | 581.54 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | ethyl 6-[(1S,4S,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,2,3,4-tetrahydronaphthalene-2-carboxylate |
| SMILES | CCOC(=O)C1CCc2cc(N3C[C@@H]4C[C@H]3C[C@H]4OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)ccc2C1 |
| InChI | InChI=1S/C32H34Cl2N2O4/c1-2-38-32(37)21-9-8-20-13-23(11-10-19(20)12-21)36-16-22-14-24(36)15-28(22)39-17-25-30(35-40-31(25)18-6-7-18)29-26(33)4-3-5-27(29)34/h3-5,10-11,13,18,21-22,24,28H,2,6-9,12,14-17H2,1H3/t21?,22-,24-,28+/m0/s1 |
| InChIKey | FUTMUVYEZQGIIG-CEWWRZJHSA-N |
| XLogP | 7.38 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.54 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|