C31H34Cl2N4O6S — CID 139345484
6-[(1R,3S,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-N-(oxan-4-ylsulfonyl)pyridine-3-carboxamide (PubChem CID 139345484) has the molecular formula C31H34Cl2N4O6S and a molecular weight of 661.61 g/mol. Its IUPAC name is 6-[(1R,3S,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-N-(oxan-4-ylsulfonyl)pyridine-3-carboxamide.
| Compound Name | 6-[(1R,3S,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-N-(oxan-4-ylsulfonyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139345484 |
| Molecular Formula | C31H34Cl2N4O6S |
| Molecular Weight | 661.61 g/mol |
| Exact Mass | 660.16 |
| IUPAC Name | 6-[(1R,3S,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-methyl-2-azabicyclo[2.2.1]heptan-2-yl]-N-(oxan-4-ylsulfonyl)pyridine-3-carboxamide |
| SMILES | C[C@H]1[C@H]2C[C@H](C[C@@H]2OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)N1c1ccc(C(=O)NS(=O)(=O)C2CCOCC2)cn1 |
| InChI | InChI=1S/C31H34Cl2N4O6S/c1-17-22-13-20(37(17)27-8-7-19(15-34-27)31(38)36-44(39,40)21-9-11-41-12-10-21)14-26(22)42-16-23-29(35-43-30(23)18-5-6-18)28-24(32)3-2-4-25(28)33/h2-4,7-8,15,17-18,20-22,26H,5-6,9-14,16H2,1H3,(H,36,38)/t17-,20+,22+,26-/m0/s1 |
| InChIKey | OJWLODSPMRSRTN-DVWYVKNESA-N |
| XLogP | 5.73 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.61 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |