C26H23Cl2N3O7S — CID 155766878
[4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]benzoyl]sulfamic acid (PubChem CID 155766878) has the molecular formula C26H23Cl2N3O7S and a molecular weight of 592.46 g/mol. Its IUPAC name is [4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]benzoyl]sulfamic acid.
| Compound Name | [4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]benzoyl]sulfamic acid |
|---|---|
| PubChem CID | 155766878 |
| Molecular Formula | C26H23Cl2N3O7S |
| Molecular Weight | 592.46 g/mol |
| Exact Mass | 591.06 |
| IUPAC Name | [4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]benzoyl]sulfamic acid |
| SMILES | O=C(NS(=O)(=O)O)c1ccc(N2C(=O)[C@@H]3C[C@H]2C[C@H]3OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cc1 |
| InChI | InChI=1S/C26H23Cl2N3O7S/c27-19-2-1-3-20(28)22(19)23-18(24(38-29-23)13-4-5-13)12-37-21-11-16-10-17(21)26(33)31(16)15-8-6-14(7-9-15)25(32)30-39(34,35)36/h1-3,6-9,13,16-17,21H,4-5,10-12H2,(H,30,32)(H,34,35,36)/t16-,17+,21+/m0/s1 |
| InChIKey | JVBZAUJEVFKUGC-CSODHUTKSA-N |
| XLogP | 4.77 |
| TPSA | 139.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.46 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|