C27H25Cl2N3O5 — CID 139345194
3-[5-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-pyridinyl]propanoic acid (PubChem CID 139345194) has the molecular formula C27H25Cl2N3O5 and a molecular weight of 542.42 g/mol. Its IUPAC name is 3-[5-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-pyridinyl]propanoic acid.
| Compound Name | 3-[5-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-pyridinyl]propanoic acid |
|---|---|
| PubChem CID | 139345194 |
| Molecular Formula | C27H25Cl2N3O5 |
| Molecular Weight | 542.42 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 3-[5-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-pyridinyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(N2C(=O)[C@@H]3C[C@H]2C[C@H]3OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cn1 |
| InChI | InChI=1S/C27H25Cl2N3O5/c28-20-2-1-3-21(29)24(20)25-19(26(37-31-25)14-4-5-14)13-36-22-11-17-10-18(22)27(35)32(17)16-8-6-15(30-12-16)7-9-23(33)34/h1-3,6,8,12,14,17-18,22H,4-5,7,9-11,13H2,(H,33,34)/t17-,18+,22+/m0/s1 |
| InChIKey | OVWZTCKNYVVUPK-NJNPRVFISA-N |
| XLogP | 5.65 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |