C31H30Cl2FN3O7S — CID 139345336
(2-sulfamoylcyclopentyl) 4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoate (PubChem CID 139345336) has the molecular formula C31H30Cl2FN3O7S and a molecular weight of 678.57 g/mol. Its IUPAC name is (2-sulfamoylcyclopentyl) 4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoate.
| Compound Name | (2-sulfamoylcyclopentyl) 4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 139345336 |
| Molecular Formula | C31H30Cl2FN3O7S |
| Molecular Weight | 678.57 g/mol |
| Exact Mass | 677.12 |
| IUPAC Name | (2-sulfamoylcyclopentyl) 4-[(1S,4R,5R)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-3-oxo-2-azabicyclo[2.2.1]heptan-2-yl]-2-fluorobenzoate |
| SMILES | NS(=O)(=O)C1CCCC1OC(=O)c1ccc(N2C(=O)[C@@H]3C[C@H]2C[C@H]3OCc2c(-c3c(Cl)cccc3Cl)noc2C2CC2)cc1F |
| InChI | InChI=1S/C31H30Cl2FN3O7S/c32-21-3-1-4-22(33)27(21)28-20(29(44-36-28)15-7-8-15)14-42-25-13-17-11-19(25)30(38)37(17)16-9-10-18(23(34)12-16)31(39)43-24-5-2-6-26(24)45(35,40)41/h1,3-4,9-10,12,15,17,19,24-26H,2,5-8,11,13-14H2,(H2,35,40,41)/t17-,19+,24?,25+,26?/m0/s1 |
| InChIKey | HSMPNOSTRRTOND-ZFXLIMPQSA-N |
| XLogP | 5.74 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |