C32H31Cl2N3O4S — CID 139345712
4-cyclopentyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 139345712) has the molecular formula C32H31Cl2N3O4S and a molecular weight of 624.59 g/mol. Its IUPAC name is 4-cyclopentyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 4-cyclopentyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 139345712 |
| Molecular Formula | C32H31Cl2N3O4S |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | 4-cyclopentyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1cc(C2CCCC2)c2nc(N3C[C@H]4C[C@@H]3C[C@@H]4OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)sc2c1 |
| InChI | InChI=1S/C32H31Cl2N3O4S/c33-23-6-3-7-24(34)27(23)29-22(30(41-36-29)17-8-9-17)15-40-25-13-20-10-19(25)14-37(20)32-35-28-21(16-4-1-2-5-16)11-18(31(38)39)12-26(28)42-32/h3,6-7,11-12,16-17,19-20,25H,1-2,4-5,8-10,13-15H2,(H,38,39)/t19-,20-,25+/m1/s1 |
| InChIKey | JWKBDAPPDWZQFR-FHAGJXEFSA-N |
| XLogP | 8.68 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |