C32H31Cl2N3O4S — CID 139364997
methyl 4-cyclobutyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylate (PubChem CID 139364997) has the molecular formula C32H31Cl2N3O4S and a molecular weight of 624.59 g/mol. Its IUPAC name is methyl 4-cyclobutyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 4-cyclobutyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 139364997 |
| Molecular Formula | C32H31Cl2N3O4S |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | methyl 4-cyclobutyl-2-[(1R,4R,5S)-5-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1cc(C2CCC2)c2nc(N3C[C@H]4C[C@@H]3C[C@@H]4OCc3c(-c4c(Cl)cccc4Cl)noc3C3CC3)sc2c1 |
| InChI | InChI=1S/C32H31Cl2N3O4S/c1-39-31(38)18-11-21(16-4-2-5-16)28-26(12-18)42-32(35-28)37-14-19-10-20(37)13-25(19)40-15-22-29(36-41-30(22)17-8-9-17)27-23(33)6-3-7-24(27)34/h3,6-7,11-12,16-17,19-20,25H,2,4-5,8-10,13-15H2,1H3/t19-,20-,25+/m1/s1 |
| InChIKey | UUAXNWNGQKAOJB-FHAGJXEFSA-N |
| XLogP | 8.37 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |