C28H22Cl2FN3O5S — CID 139345693
[(1S,4S,5S)-2-(4-fluoro-6-methoxycarbonyl-1,3-benzothiazol-2-yl)-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 139345693) has the molecular formula C28H22Cl2FN3O5S and a molecular weight of 602.47 g/mol. Its IUPAC name is [(1S,4S,5S)-2-(4-fluoro-6-methoxycarbonyl-1,3-benzothiazol-2-yl)-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | [(1S,4S,5S)-2-(4-fluoro-6-methoxycarbonyl-1,3-benzothiazol-2-yl)-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 139345693 |
| Molecular Formula | C28H22Cl2FN3O5S |
| Molecular Weight | 602.47 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | [(1S,4S,5S)-2-(4-fluoro-6-methoxycarbonyl-1,3-benzothiazol-2-yl)-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1cc(F)c2nc(N3C[C@@H]4C[C@H]3C[C@@H]4OC(=O)c3c(-c4c(Cl)cccc4Cl)noc3C3CC3)sc2c1 |
| InChI | InChI=1S/C28H22Cl2FN3O5S/c1-37-26(35)13-8-18(31)23-20(9-13)40-28(32-23)34-11-14-7-15(34)10-19(14)38-27(36)22-24(33-39-25(22)12-5-6-12)21-16(29)3-2-4-17(21)30/h2-4,8-9,12,14-15,19H,5-7,10-11H2,1H3/t14-,15-,19-/m0/s1 |
| InChIKey | MDYALTLLKYTQNV-DOXZYTNZSA-N |
| XLogP | 6.89 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.47 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |