C28H24Cl2FN3O4S — CID 153418845
methyl 2-[(1R,4S,6R)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate (PubChem CID 153418845) has the molecular formula C28H24Cl2FN3O4S and a molecular weight of 588.49 g/mol. Its IUPAC name is methyl 2-[(1R,4S,6R)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[(1R,4S,6R)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 153418845 |
| Molecular Formula | C28H24Cl2FN3O4S |
| Molecular Weight | 588.49 g/mol |
| Exact Mass | 587.08 |
| IUPAC Name | methyl 2-[(1R,4S,6R)-6-[[5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazol-4-yl]methoxy]-2-azabicyclo[2.2.1]heptan-2-yl]-4-fluoro-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1cc(F)c2nc(N3C[C@H]4C[C@@H]3[C@H](OCc3c(-c5c(Cl)cccc5Cl)noc3C3CC3)C4)sc2c1 |
| InChI | InChI=1S/C28H24Cl2FN3O4S/c1-36-27(35)15-9-19(31)25-22(10-15)39-28(32-25)34-11-13-7-20(34)21(8-13)37-12-16-24(33-38-26(16)14-5-6-14)23-17(29)3-2-4-18(23)30/h2-4,9-10,13-14,20-21H,5-8,11-12H2,1H3/t13-,20+,21+/m0/s1 |
| InChIKey | PXHXAMRIIHIOHH-JDORSLCVSA-N |
| XLogP | 7.25 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.49 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |