C28H23Cl2FN4O6S2 — CID 134284823
[(1S,4S,5R)-2-[4-fluoro-6-(methylsulfonylcarbamoyl)-1,3-benzothiazol-2-yl]-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate (PubChem CID 134284823) has the molecular formula C28H23Cl2FN4O6S2 and a molecular weight of 665.55 g/mol. Its IUPAC name is [(1S,4S,5R)-2-[4-fluoro-6-(methylsulfonylcarbamoyl)-1,3-benzothiazol-2-yl]-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate.
| Compound Name | [(1S,4S,5R)-2-[4-fluoro-6-(methylsulfonylcarbamoyl)-1,3-benzothiazol-2-yl]-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 134284823 |
| Molecular Formula | C28H23Cl2FN4O6S2 |
| Molecular Weight | 665.55 g/mol |
| Exact Mass | 664.04 |
| IUPAC Name | [(1S,4S,5R)-2-[4-fluoro-6-(methylsulfonylcarbamoyl)-1,3-benzothiazol-2-yl]-2-azabicyclo[2.2.1]heptan-5-yl] 5-cyclopropyl-3-(2,6-dichlorophenyl)-1,2-oxazole-4-carboxylate |
| SMILES | CS(=O)(=O)NC(=O)c1cc(F)c2nc(N3C[C@@H]4C[C@H]3C[C@H]4OC(=O)c3c(-c4c(Cl)cccc4Cl)noc3C3CC3)sc2c1 |
| InChI | InChI=1S/C28H23Cl2FN4O6S2/c1-43(38,39)34-26(36)13-8-18(31)23-20(9-13)42-28(32-23)35-11-14-7-15(35)10-19(14)40-27(37)22-24(33-41-25(22)12-5-6-12)21-16(29)3-2-4-17(21)30/h2-4,8-9,12,14-15,19H,5-7,10-11H2,1H3,(H,34,36)/t14-,15-,19+/m0/s1 |
| InChIKey | LTLPLDRRVNAPTB-YZVOILCLSA-N |
| XLogP | 5.79 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |