C22H20ClN7O2 — CID 139346007
1-[4-[8-[(6-chloro-5-methyl-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 139346007) has the molecular formula C22H20ClN7O2 and a molecular weight of 449.90 g/mol. Its IUPAC name is 1-[4-[8-[(6-chloro-5-methyl-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[8-[(6-chloro-5-methyl-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139346007 |
| Molecular Formula | C22H20ClN7O2 |
| Molecular Weight | 449.90 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-[4-[8-[(6-chloro-5-methyl-1H-indazol-4-yl)oxy]pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(Oc4c(C)c(Cl)cc5[nH]ncc45)nccc23)CC1 |
| InChI | InChI=1S/C22H20ClN7O2/c1-3-18(31)29-6-8-30(9-7-29)21-14-4-5-24-22(19(14)25-12-26-21)32-20-13(2)16(23)10-17-15(20)11-27-28-17/h3-5,10-12H,1,6-9H2,2H3,(H,27,28) |
| InChIKey | TXIFYOQPZVWTQJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.90 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|