C22H14F4N2OS — CID 139346486
(E)-3-(4-fluorophenyl)-N-[3-(trifluoromethyl)-10H-phenothiazin-1-yl]prop-2-enamide (PubChem CID 139346486) has the molecular formula C22H14F4N2OS and a molecular weight of 430.43 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[3-(trifluoromethyl)-10H-phenothiazin-1-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[3-(trifluoromethyl)-10H-phenothiazin-1-yl]prop-2-enamide |
|---|---|
| PubChem CID | 139346486 |
| Molecular Formula | C22H14F4N2OS |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.08 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[3-(trifluoromethyl)-10H-phenothiazin-1-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)Nc1cc(C(F)(F)F)cc2c1Nc1ccccc1S2 |
| InChI | InChI=1S/C22H14F4N2OS/c23-15-8-5-13(6-9-15)7-10-20(29)27-17-11-14(22(24,25)26)12-19-21(17)28-16-3-1-2-4-18(16)30-19/h1-12,28H,(H,27,29)/b10-7+ |
| InChIKey | DQWJRPRIFRYKNH-JXMROGBWSA-N |
| XLogP | 6.70 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|