C7H10BrN — CID 139347531
5-bromo-1,3-dimethyl-2H-pyridine (PubChem CID 139347531) has the molecular formula C7H10BrN and a molecular weight of 188.07 g/mol. Its IUPAC name is 5-bromo-1,3-dimethyl-2H-pyridine.
| Compound Name | 5-bromo-1,3-dimethyl-2H-pyridine |
|---|---|
| PubChem CID | 139347531 |
| Molecular Formula | C7H10BrN |
| Molecular Weight | 188.07 g/mol |
| Exact Mass | 187.00 |
| IUPAC Name | 5-bromo-1,3-dimethyl-2H-pyridine |
| SMILES | CC1=CC(Br)=CN(C)C1 |
| InChI | InChI=1S/C7H10BrN/c1-6-3-7(8)5-9(2)4-6/h3,5H,4H2,1-2H3 |
| InChIKey | LEJZSUSWPVEKQE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |