C11H11FN4O3 — CID 139347552
2-fluoro-4-[(2R)-2-hydroxy-3-(tetrazol-1-yl)propoxy]benzaldehyde (PubChem CID 139347552) has the molecular formula C11H11FN4O3 and a molecular weight of 266.23 g/mol. Its IUPAC name is 2-fluoro-4-[(2R)-2-hydroxy-3-(tetrazol-1-yl)propoxy]benzaldehyde.
| Compound Name | 2-fluoro-4-[(2R)-2-hydroxy-3-(tetrazol-1-yl)propoxy]benzaldehyde |
|---|---|
| PubChem CID | 139347552 |
| Molecular Formula | C11H11FN4O3 |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | 2-fluoro-4-[(2R)-2-hydroxy-3-(tetrazol-1-yl)propoxy]benzaldehyde |
| SMILES | O=Cc1ccc(OC[C@H](O)Cn2cnnn2)cc1F |
| InChI | InChI=1S/C11H11FN4O3/c12-11-3-10(2-1-8(11)5-17)19-6-9(18)4-16-7-13-14-15-16/h1-3,5,7,9,18H,4,6H2/t9-/m1/s1 |
| InChIKey | INTWHELJQWGJMF-SECBINFHSA-N |
| XLogP | 0.06 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|