C31H36F2N8O4 — CID 139353631
3-fluoro-2-[(3R,4S)-3-fluoro-1-(2-hydroxypropanoyl)piperidin-4-yl]oxy-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,4-dihydro-1,3,5-triazin-4-yl]benzonitrile (PubChem CID 139353631) has the molecular formula C31H36F2N8O4 and a molecular weight of 622.68 g/mol. Its IUPAC name is 3-fluoro-2-[(3R,4S)-3-fluoro-1-(2-hydroxypropanoyl)piperidin-4-yl]oxy-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,4-dihydro-1,3,5-triazin-4-yl]benzonitrile.
| Compound Name | 3-fluoro-2-[(3R,4S)-3-fluoro-1-(2-hydroxypropanoyl)piperidin-4-yl]oxy-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,4-dihydro-1,3,5-triazin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 139353631 |
| Molecular Formula | C31H36F2N8O4 |
| Molecular Weight | 622.68 g/mol |
| Exact Mass | 622.28 |
| IUPAC Name | 3-fluoro-2-[(3R,4S)-3-fluoro-1-(2-hydroxypropanoyl)piperidin-4-yl]oxy-5-[2-[4-[4-(oxetan-3-yl)piperazin-1-yl]anilino]-1,4-dihydro-1,3,5-triazin-4-yl]benzonitrile |
| SMILES | CC(O)C(=O)N1CC[C@H](Oc2c(F)cc(C3N=CNC(Nc4ccc(N5CCN(C6COC6)CC5)cc4)=N3)cc2C#N)[C@H](F)C1 |
| InChI | InChI=1S/C31H36F2N8O4/c1-19(42)30(43)41-7-6-27(26(33)15-41)45-28-21(14-34)12-20(13-25(28)32)29-35-18-36-31(38-29)37-22-2-4-23(5-3-22)39-8-10-40(11-9-39)24-16-44-17-24/h2-5,12-13,18-19,24,26-27,29,42H,6-11,15-17H2,1H3,(H2,35,36,37,38)/t19?,26-,27+,29?/m1/s1 |
| InChIKey | LOVIYIIGKHCYIY-KMTCDHOSSA-N |
| XLogP | 2.01 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.68 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|