C36H27N2OP — CID 139356041
15-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide (PubChem CID 139356041) has the molecular formula C36H27N2OP and a molecular weight of 534.60 g/mol. Its IUPAC name is 15-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide.
| Compound Name | 15-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide |
|---|---|
| PubChem CID | 139356041 |
| Molecular Formula | C36H27N2OP |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 15-[4-[3-[(1Z)-buta-1,3-dienyl]-4-methylphenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide |
| SMILES | C=C/C=C\c1cc(-c2ccc(-c3nc4cccc5c4n3-c3ccccc3P5(=O)c3ccccc3)cc2)ccc1C |
| InChI | InChI=1S/C36H27N2OP/c1-3-4-11-28-24-29(19-18-25(28)2)26-20-22-27(23-21-26)36-37-31-14-10-17-34-35(31)38(36)32-15-8-9-16-33(32)40(34,39)30-12-6-5-7-13-30/h3-24H,1H2,2H3/b11-4- |
| InChIKey | QEEVXLHSRSBRRK-WCIBSUBMSA-N |
| XLogP | 7.82 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|