C43H29N2OP — CID 122486934
6-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8,15-diphenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide (PubChem CID 122486934) has the molecular formula C43H29N2OP and a molecular weight of 625.72 g/mol. Its IUPAC name is 6-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8,15-diphenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide.
| Compound Name | 6-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8,15-diphenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide |
|---|---|
| PubChem CID | 122486934 |
| Molecular Formula | C43H29N2OP |
| Molecular Weight | 625.72 g/mol |
| Exact Mass | 625.23 |
| IUPAC Name | 6-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8,15-diphenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene 8-oxide |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(-c4cccc5c4P(=O)(c4ccccc4)c4cccc6nc(-c7ccccc7)n-5c46)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C43H29N2OP/c46-47(36-16-8-3-9-17-36)40-21-11-19-38-41(40)45(43(44-38)35-14-6-2-7-15-35)39-20-10-18-37(42(39)47)34-28-26-33(27-29-34)32-24-22-31(23-25-32)30-12-4-1-5-13-30/h1-29H/i1D,4D,5D,12D,13D |
| InChIKey | AJBSXDRAZMGOIY-RJUHWWGZSA-N |
| XLogP | 9.65 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.72 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|