C39H29N2OP — CID 122486775
15-ethyl-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8-oxide (PubChem CID 122486775) has the molecular formula C39H29N2OP and a molecular weight of 577.68 g/mol. Its IUPAC name is 15-ethyl-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8-oxide.
| Compound Name | 15-ethyl-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8-oxide |
|---|---|
| PubChem CID | 122486775 |
| Molecular Formula | C39H29N2OP |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.23 |
| IUPAC Name | 15-ethyl-5-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,14-diaza-8λ5-phosphatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene 8-oxide |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(-c4ccc5c(c4)P(=O)(c4ccccc4)c4cccc6nc(CC)n-5c46)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H29N2OP/c1-2-38-40-34-14-9-15-36-39(34)41(38)35-25-24-32(26-37(35)43(36,42)33-12-7-4-8-13-33)31-22-20-30(21-23-31)29-18-16-28(17-19-29)27-10-5-3-6-11-27/h3-26H,2H2,1H3/i3D,5D,6D,10D,11D |
| InChIKey | IHGINRHLTHBOEJ-KILXEUBNSA-N |
| XLogP | 8.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|