C39H29N3 — CID 122493004
15-ethyl-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,8,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene (PubChem CID 122493004) has the molecular formula C39H29N3 and a molecular weight of 544.71 g/mol. Its IUPAC name is 15-ethyl-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,8,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene.
| Compound Name | 15-ethyl-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,8,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene |
|---|---|
| PubChem CID | 122493004 |
| Molecular Formula | C39H29N3 |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.27 |
| IUPAC Name | 15-ethyl-4-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-phenyl-1,8,14-triazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(-c4ccc5c(c4)-n4c(CC)nc6cccc(c64)N5c4ccccc4)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C39H29N3/c1-2-38-40-34-14-9-15-36-39(34)42(38)37-26-32(24-25-35(37)41(36)33-12-7-4-8-13-33)31-22-20-30(21-23-31)29-18-16-28(17-19-29)27-10-5-3-6-11-27/h3-26H,2H2,1H3/i3D,5D,6D,10D,11D |
| InChIKey | ZWAUFFXCCDJDMZ-KILXEUBNSA-N |
| XLogP | 10.37 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |