C33H24N2O — CID 122469500
15-ethyl-11-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene (PubChem CID 122469500) has the molecular formula C33H24N2O and a molecular weight of 469.60 g/mol. Its IUPAC name is 15-ethyl-11-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene.
| Compound Name | 15-ethyl-11-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene |
|---|---|
| PubChem CID | 122469500 |
| Molecular Formula | C33H24N2O |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | 15-ethyl-11-[4-[4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]phenyl]-8-oxa-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2,4,6,9,11,13(16),14-heptaene |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc(-c3ccc(-c4cc5c6c(c4)nc(CC)n6-c4ccccc4O5)cc3)cc2)c([2H])c1[2H] |
| InChI | InChI=1S/C33H24N2O/c1-2-32-34-28-20-27(21-31-33(28)35(32)29-10-6-7-11-30(29)36-31)26-18-16-25(17-19-26)24-14-12-23(13-15-24)22-8-4-3-5-9-22/h3-21H,2H2,1H3/i3D,4D,5D,8D,9D |
| InChIKey | DHMLMHJZQNQODE-YQYLVRRTSA-N |
| XLogP | 8.69 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |