C47H34N2 — CID 169070522
1-[2-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-ethylbenzimidazole (PubChem CID 169070522) has the molecular formula C47H34N2 and a molecular weight of 644.91 g/mol. Its IUPAC name is 1-[2-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-ethylbenzimidazole.
| Compound Name | 1-[2-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-ethylbenzimidazole |
|---|---|
| PubChem CID | 169070522 |
| Molecular Formula | C47H34N2 |
| Molecular Weight | 644.91 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | 1-[2-[10-[3,5-bis(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,2,3,4,5,6,7,8-octadeuterioanthracen-9-yl]phenyl]-2-ethylbenzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])cc(-c3c4c([2H])c([2H])c([2H])c([2H])c4c(-c4ccccc4-n4c(CC)nc5ccccc54)c4c([2H])c([2H])c([2H])c([2H])c34)c2)c([2H])c1[2H] |
| InChI | InChI=1S/C47H34N2/c1-2-45-48-42-26-14-16-28-44(42)49(45)43-27-15-13-25-41(43)47-39-23-11-9-21-37(39)46(38-22-10-12-24-40(38)47)36-30-34(32-17-5-3-6-18-32)29-35(31-36)33-19-7-4-8-20-33/h3-31H,2H2,1H3/i3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,17D,18D,19D,20D,21D,22D,23D,24D |
| InChIKey | TYRZKKHCFDHMNB-BOHBGZJXSA-N |
| XLogP | 12.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.91 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|