C41H30N2 — CID 169071719
2-ethyl-1-[2-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]benzimidazole (PubChem CID 169071719) has the molecular formula C41H30N2 and a molecular weight of 555.74 g/mol. Its IUPAC name is 2-ethyl-1-[2-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]benzimidazole.
| Compound Name | 2-ethyl-1-[2-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169071719 |
| Molecular Formula | C41H30N2 |
| Molecular Weight | 555.74 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | 2-ethyl-1-[2-[3-(2,3,4,5,6-pentadeuteriophenyl)-10-phenylanthracen-9-yl]phenyl]benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3c(-c4ccccc4-n4c(CC)nc5ccccc54)c4ccccc4c(-c4ccccc4)c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C41H30N2/c1-2-39-42-36-22-12-14-24-38(36)43(39)37-23-13-11-21-34(37)41-32-20-10-9-19-31(32)40(29-17-7-4-8-18-29)35-27-30(25-26-33(35)41)28-15-5-3-6-16-28/h3-27H,2H2,1H3/i3D,5D,6D,15D,16D |
| InChIKey | JUALETQTIHTZBJ-JXPHPVJHSA-N |
| XLogP | 10.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.74 |
| LogP ≤ 5 | 10.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|