C53H38N2 — CID 169071897
1-[2-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole (PubChem CID 169071897) has the molecular formula C53H38N2 and a molecular weight of 715.98 g/mol. Its IUPAC name is 1-[2-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole.
| Compound Name | 1-[2-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
|---|---|
| PubChem CID | 169071897 |
| Molecular Formula | C53H38N2 |
| Molecular Weight | 715.98 g/mol |
| Exact Mass | 715.39 |
| IUPAC Name | 1-[2-[4-[1,2,3,4,5,6,7,8-octadeuterio-10-(3,5-diphenylphenyl)anthracen-9-yl]phenyl]phenyl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
| SMILES | [2H]c1c([2H])c([2H])c2c(-c3cc(-c4ccccc4)cc(-c4ccccc4)c3)c3c([2H])c([2H])c([2H])c([2H])c3c(-c3ccc(-c4ccccc4-n4c(C([2H])([2H])C([2H])([2H])[2H])nc5ccccc54)cc3)c2c1[2H] |
| InChI | InChI=1S/C53H38N2/c1-2-51-54-48-26-14-16-28-50(48)55(51)49-27-15-13-21-43(49)38-29-31-39(32-30-38)52-44-22-9-11-24-46(44)53(47-25-12-10-23-45(47)52)42-34-40(36-17-5-3-6-18-36)33-41(35-42)37-19-7-4-8-20-37/h3-35H,2H2,1H3/i1D3,2D2,9D,10D,11D,12D,22D,23D,24D,25D |
| InChIKey | RTPFTJNYCRLCEU-HJEVFUBISA-N |
| XLogP | 14.23 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.98 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|