C40H29N3 — CID 169070441
2-(1,1,2,2,2-pentadeuterioethyl)-1-[2-[10-(3-pyridin-4-ylphenyl)anthracen-9-yl]phenyl]benzimidazole (PubChem CID 169070441) has the molecular formula C40H29N3 and a molecular weight of 556.72 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentadeuterioethyl)-1-[2-[10-(3-pyridin-4-ylphenyl)anthracen-9-yl]phenyl]benzimidazole.
| Compound Name | 2-(1,1,2,2,2-pentadeuterioethyl)-1-[2-[10-(3-pyridin-4-ylphenyl)anthracen-9-yl]phenyl]benzimidazole |
|---|---|
| PubChem CID | 169070441 |
| Molecular Formula | C40H29N3 |
| Molecular Weight | 556.72 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 2-(1,1,2,2,2-pentadeuterioethyl)-1-[2-[10-(3-pyridin-4-ylphenyl)anthracen-9-yl]phenyl]benzimidazole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1nc2ccccc2n1-c1ccccc1-c1c2ccccc2c(-c2cccc(-c3ccncc3)c2)c2ccccc12 |
| InChI | InChI=1S/C40H29N3/c1-2-38-42-35-19-8-10-21-37(35)43(38)36-20-9-7-18-34(36)40-32-16-5-3-14-30(32)39(31-15-4-6-17-33(31)40)29-13-11-12-28(26-29)27-22-24-41-25-23-27/h3-26H,2H2,1H3/i1D3,2D2 |
| InChIKey | DYNVCNPFLSKGCC-ZBJDZAJPSA-N |
| XLogP | 10.29 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.72 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|