C43H30N2 — CID 169071363
1-[4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole (PubChem CID 169071363) has the molecular formula C43H30N2 and a molecular weight of 579.76 g/mol. Its IUPAC name is 1-[4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole.
| Compound Name | 1-[4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
|---|---|
| PubChem CID | 169071363 |
| Molecular Formula | C43H30N2 |
| Molecular Weight | 579.76 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 1-[4-(10-naphthalen-1-ylanthracen-9-yl)naphthalen-1-yl]-2-(1,1,2,2,2-pentadeuterioethyl)benzimidazole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1nc2ccccc2n1-c1ccc(-c2c3ccccc3c(-c3cccc4ccccc34)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C43H30N2/c1-2-41-44-38-24-11-12-25-40(38)45(41)39-27-26-37(30-17-5-6-18-31(30)39)43-35-21-9-7-19-33(35)42(34-20-8-10-22-36(34)43)32-23-13-15-28-14-3-4-16-29(28)32/h3-27H,2H2,1H3/i1D3,2D2 |
| InChIKey | UNGKJWVLISQNAK-ZBJDZAJPSA-N |
| XLogP | 11.53 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.76 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|